About 2-methylidene-3,3-dipropylpyrrolidine
2-methylidene-3,3-dipropylpyrrolidine (PubChem CID 126661388) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-methylidene-3,3-dipropylpyrrolidine.
Molecular Properties
| Compound Name | 2-methylidene-3,3-dipropylpyrrolidine |
| PubChem CID | 126661388 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-methylidene-3,3-dipropylpyrrolidine |
| SMILES | C=C1NCCC1(CCC)CCC |
| InChI | InChI=1S/C11H21N/c1-4-6-11(7-5-2)8-9-12-10(11)3/h12H,3-9H2,1-2H3 |
| InChIKey | JSNAVCWPVXTWAE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylidene-3,3-dipropylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3,3-dipropylpyrrolidine?
The IUPAC name of 2-methylidene-3,3-dipropylpyrrolidine (CID 126661388) is 2-methylidene-3,3-dipropylpyrrolidine.
What is the SMILES notation for 2-methylidene-3,3-dipropylpyrrolidine?
The canonical SMILES for 2-methylidene-3,3-dipropylpyrrolidine is C=C1NCCC1(CCC)CCC.
What is the InChIKey of 2-methylidene-3,3-dipropylpyrrolidine?
The InChIKey is JSNAVCWPVXTWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-4-6-11(7-5-2)8-9-12-10(11)3/h12H,3-9H2,1-2H3.
What are the key properties of 2-methylidene-3,3-dipropylpyrrolidine?
2-methylidene-3,3-dipropylpyrrolidine has a molecular weight of 167.30 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3,3-dipropylpyrrolidine is sourced from PubChem (CID 126661388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).