About 3-methoxyinden-1-one
3-methoxyinden-1-one (PubChem CID 12666139) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-methoxyinden-1-one.
Molecular Properties
| Compound Name | 3-methoxyinden-1-one |
| PubChem CID | 12666139 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 3-methoxyinden-1-one |
| SMILES | COC1=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H8O2/c1-12-10-6-9(11)7-4-2-3-5-8(7)10/h2-6H,1H3 |
| InChIKey | LMCNBTGTQXMSHF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxyinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyinden-1-one?
The IUPAC name of 3-methoxyinden-1-one (CID 12666139) is 3-methoxyinden-1-one.
What is the SMILES notation for 3-methoxyinden-1-one?
The canonical SMILES for 3-methoxyinden-1-one is COC1=CC(=O)c2ccccc21.
What is the InChIKey of 3-methoxyinden-1-one?
The InChIKey is LMCNBTGTQXMSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c1-12-10-6-9(11)7-4-2-3-5-8(7)10/h2-6H,1H3.
What are the key properties of 3-methoxyinden-1-one?
3-methoxyinden-1-one has a molecular weight of 160.17 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyinden-1-one is sourced from PubChem (CID 12666139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).