About 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine
1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine (PubChem CID 126661394) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
| PubChem CID | 126661394 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
| SMILES | C=C(C)C(=C/C)/N=C(\C)C1=CC=CC1 |
| InChI | InChI=1S/C13H17N/c1-5-13(10(2)3)14-11(4)12-8-6-7-9-12/h5-8H,2,9H2,1,3-4H3/b13-5-,14-11+ |
| InChIKey | ITRVTMJCTJTEBU-JOVOQDLISA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine (CID 126661394) is 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine is C=C(C)C(=C/C)/N=C(\C)C1=CC=CC1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine?
The InChIKey is ITRVTMJCTJTEBU-JOVOQDLISA-N. The full InChI is InChI=1S/C13H17N/c1-5-13(10(2)3)14-11(4)12-8-6-7-9-12/h5-8H,2,9H2,1,3-4H3/b13-5-,14-11+.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine?
1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine has a molecular weight of 187.29 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine is sourced from PubChem (CID 126661394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).