C7H9NO4S — CID 126661518
ethyl 4-(dihydroxymethyl)-1,3-thiazole-2-carboxylate (PubChem CID 126661518) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is ethyl 4-(dihydroxymethyl)-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-(dihydroxymethyl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 126661518 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | ethyl 4-(dihydroxymethyl)-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(O)O)cs1 |
| InChI | InChI=1S/C7H9NO4S/c1-2-12-7(11)5-8-4(3-13-5)6(9)10/h3,6,9-10H,2H2,1H3 |
| InChIKey | NNABQOVYZPTSSF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|