C26H26N6O3S3 — CID 126661540
N-[2-[4-[4-(1-aminoethylideneamino)phenyl]sulfonylpiperazin-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 126661540) has the molecular formula C26H26N6O3S3 and a molecular weight of 566.73 g/mol. Its IUPAC name is N-[2-[4-[4-(1-aminoethylideneamino)phenyl]sulfonylpiperazin-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[4-[4-(1-aminoethylideneamino)phenyl]sulfonylpiperazin-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126661540 |
| Molecular Formula | C26H26N6O3S3 |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | N-[2-[4-[4-(1-aminoethylideneamino)phenyl]sulfonylpiperazin-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | C/C(N)=N\c1ccc(S(=O)(=O)N2CCN(c3ccccc3NC(=O)c3csc(-c4cccs4)n3)CC2)cc1 |
| InChI | InChI=1S/C26H26N6O3S3/c1-18(27)28-19-8-10-20(11-9-19)38(34,35)32-14-12-31(13-15-32)23-6-3-2-5-21(23)29-25(33)22-17-37-26(30-22)24-7-4-16-36-24/h2-11,16-17H,12-15H2,1H3,(H2,27,28)(H,29,33) |
| InChIKey | MVWJDJQJJWIXGK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|