About (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal
(Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal (PubChem CID 126661583) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal.
Molecular Properties
| Compound Name | (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal |
| PubChem CID | 126661583 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal |
| SMILES | C/C=C\C(=C/C)\C(C)=N\C(C=O)=C/C |
| InChI | InChI=1S/C12H17NO/c1-5-8-11(6-2)10(4)13-12(7-3)9-14/h5-9H,1-4H3/b8-5-,11-6+,12-7-,13-10+ |
| InChIKey | QRQQEKNXNJOCLF-NLSRSRGMSA-N |
| XLogP | 3.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal?
The IUPAC name of (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal (CID 126661583) is (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal.
What is the SMILES notation for (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal?
The canonical SMILES for (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal is C/C=C\C(=C/C)\C(C)=N\C(C=O)=C/C.
What is the InChIKey of (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal?
The InChIKey is QRQQEKNXNJOCLF-NLSRSRGMSA-N. The full InChI is InChI=1S/C12H17NO/c1-5-8-11(6-2)10(4)13-12(7-3)9-14/h5-9H,1-4H3/b8-5-,11-6+,12-7-,13-10+.
What are the key properties of (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal?
(Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal has a molecular weight of 191.27 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[[(Z,3E)-3-ethylidenehex-4-en-2-ylidene]amino]but-2-enal is sourced from PubChem (CID 126661583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).