C16H21N — CID 126661597
1-(4-ethenylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine (PubChem CID 126661597) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine.
| Compound Name | 1-(4-ethenylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 126661597 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-(4-ethenylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
| SMILES | C=CC1C=CC(/C(C)=N/C(=C\C)C(=C)C)=CC1 |
| InChI | InChI=1S/C16H21N/c1-6-14-8-10-15(11-9-14)13(5)17-16(7-2)12(3)4/h6-8,10-11,14H,1,3,9H2,2,4-5H3/b16-7-,17-13+ |
| InChIKey | WCEYOHNAUYALEA-PPRHCINDSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|