C15H20N2 — CID 126661668
(2Z,4Z)-2-methyl-3-[C-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbonimidoyl]hexa-2,4-dienenitrile (PubChem CID 126661668) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2Z,4Z)-2-methyl-3-[C-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbonimidoyl]hexa-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-2-methyl-3-[C-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbonimidoyl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 126661668 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (2Z,4Z)-2-methyl-3-[C-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]carbonimidoyl]hexa-2,4-dienenitrile |
| SMILES | C=C(C)C(=C/C)/N=C(C)\C(/C=C\C)=C(\C)C#N |
| InChI | InChI=1S/C15H20N2/c1-7-9-14(12(5)10-16)13(6)17-15(8-2)11(3)4/h7-9H,3H2,1-2,4-6H3/b9-7-,14-12-,15-8-,17-13+ |
| InChIKey | XJYNQLZGTKBAOH-LLRCURHGSA-N |
| XLogP | 4.34 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|