About N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide
N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 126661691) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide |
| PubChem CID | 126661691 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CC(C(F)(F)F)=CCC1C |
| InChI | InChI=1S/C10H12F3NO/c1-6-3-4-8(10(11,12)13)5-9(6)14-7(2)15/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | QRPHNAXZOCUGQH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide?
The IUPAC name of N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide (CID 126661691) is N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide.
What is the SMILES notation for N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide?
The canonical SMILES for N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide is CC(=O)NC1=CC(C(F)(F)F)=CCC1C.
What is the InChIKey of N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide?
The InChIKey is QRPHNAXZOCUGQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NO/c1-6-3-4-8(10(11,12)13)5-9(6)14-7(2)15/h4-6H,3H2,1-2H3,(H,14,15).
What are the key properties of N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide?
N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide has a molecular weight of 219.21 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-methyl-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]acetamide is sourced from PubChem (CID 126661691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).