C16H23N — CID 126661905
(3E,5Z)-3-ethenyl-5-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine (PubChem CID 126661905) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-5-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-3-ethenyl-5-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 126661905 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3E,5Z)-3-ethenyl-5-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine |
| SMILES | C=CC(=C\C(C)=C/C)/C(C)=N\C(=C/C)C(=C)C |
| InChI | InChI=1S/C16H23N/c1-8-13(6)11-15(9-2)14(7)17-16(10-3)12(4)5/h8-11H,2,4H2,1,3,5-7H3/b13-8-,15-11+,16-10-,17-14+ |
| InChIKey | MOBNXUMIULHTSF-UJZQITTOSA-N |
| XLogP | 5.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|