C21H35NO3 — CID 126661989
tert-butyl 4-[[(2Z,4Z,5E)-4-ethylideneocta-2,5-dienoxy]methyl]piperidine-1-carboxylate (PubChem CID 126661989) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is tert-butyl 4-[[(2Z,4Z,5E)-4-ethylideneocta-2,5-dienoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2Z,4Z,5E)-4-ethylideneocta-2,5-dienoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126661989 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | tert-butyl 4-[[(2Z,4Z,5E)-4-ethylideneocta-2,5-dienoxy]methyl]piperidine-1-carboxylate |
| SMILES | C/C=C(\C=C/COCC1CCN(C(=O)OC(C)(C)C)CC1)/C=C/CC |
| InChI | InChI=1S/C21H35NO3/c1-6-8-10-18(7-2)11-9-16-24-17-19-12-14-22(15-13-19)20(23)25-21(3,4)5/h7-11,19H,6,12-17H2,1-5H3/b10-8+,11-9-,18-7- |
| InChIKey | UHRWIRJMSNKMGS-XPDDVOAQSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|