C22H27N5O2S2 — CID 126662024
N-[2-[4-(2-hydroxy-2-methylhydrazinyl)azocan-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 126662024) has the molecular formula C22H27N5O2S2 and a molecular weight of 457.63 g/mol. Its IUPAC name is N-[2-[4-(2-hydroxy-2-methylhydrazinyl)azocan-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[4-(2-hydroxy-2-methylhydrazinyl)azocan-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126662024 |
| Molecular Formula | C22H27N5O2S2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[2-[4-(2-hydroxy-2-methylhydrazinyl)azocan-1-yl]phenyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CN(O)NC1CCCCN(c2ccccc2NC(=O)c2csc(-c3cccs3)n2)CC1 |
| InChI | InChI=1S/C22H27N5O2S2/c1-26(29)25-16-7-4-5-12-27(13-11-16)19-9-3-2-8-17(19)23-21(28)18-15-31-22(24-18)20-10-6-14-30-20/h2-3,6,8-10,14-16,25,29H,4-5,7,11-13H2,1H3,(H,23,28) |
| InChIKey | SMHDPYMNVRREPJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|