C29H39N5O3 — CID 126662066
[4-[4-[[1-(5-ethyl-1,2-dihydropyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-(3-methoxyiminoazetidin-1-yl)methanone (PubChem CID 126662066) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is [4-[4-[[1-(5-ethyl-1,2-dihydropyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-(3-methoxyiminoazetidin-1-yl)methanone.
| Compound Name | [4-[4-[[1-(5-ethyl-1,2-dihydropyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-(3-methoxyiminoazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 126662066 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | [4-[4-[[1-(5-ethyl-1,2-dihydropyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-(3-methoxyiminoazetidin-1-yl)methanone |
| SMILES | CCC1=CNC(N2CCC(COc3ccc(C4=CCC(C(=O)N5CC(=NOC)C5)CC4)cc3)CC2)N=C1 |
| InChI | InChI=1S/C29H39N5O3/c1-3-21-16-30-29(31-17-21)33-14-12-22(13-15-33)20-37-27-10-8-24(9-11-27)23-4-6-25(7-5-23)28(35)34-18-26(19-34)32-36-2/h4,8-11,16-17,22,25,29-30H,3,5-7,12-15,18-20H2,1-2H3 |
| InChIKey | VNTQKDQYVJBDPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|