C14H24O5 — CID 126662145
1,1-diethoxyethane;4,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 126662145) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1,1-diethoxyethane;4,4-dimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 1,1-diethoxyethane;4,4-dimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 126662145 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1,1-diethoxyethane;4,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | CCOC(C)OCC.COC1(OC)C=CC(=O)C=C1 |
| InChI | InChI=1S/C8H10O3.C6H14O2/c1-10-8(11-2)5-3-7(9)4-6-8;1-4-7-6(3)8-5-2/h3-6H,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | UZKRTFRIHONGMI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|