About (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol
(2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol (PubChem CID 126662243) has the molecular formula C10H13BrFNO2
and a molecular weight of 278.12 g/mol. Its IUPAC name is (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol.
Molecular Properties
| Compound Name | (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol |
| PubChem CID | 126662243 |
| Molecular Formula | C10H13BrFNO2 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol |
| SMILES | C[C@@H](Nc1ccc(Br)cc1F)[C@@H](O)CO |
| InChI | InChI=1S/C10H13BrFNO2/c1-6(10(15)5-14)13-9-3-2-7(11)4-8(9)12/h2-4,6,10,13-15H,5H2,1H3/t6-,10+/m1/s1 |
| InChIKey | DWTKUELXPAAWMT-LDWIPMOCSA-N |
| XLogP | 1.74 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol?
The IUPAC name of (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol (CID 126662243) is (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol.
What is the SMILES notation for (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol?
The canonical SMILES for (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol is C[C@@H](Nc1ccc(Br)cc1F)[C@@H](O)CO.
What is the InChIKey of (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol?
The InChIKey is DWTKUELXPAAWMT-LDWIPMOCSA-N. The full InChI is InChI=1S/C10H13BrFNO2/c1-6(10(15)5-14)13-9-3-2-7(11)4-8(9)12/h2-4,6,10,13-15H,5H2,1H3/t6-,10+/m1/s1.
What are the key properties of (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol?
(2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol has a molecular weight of 278.12 g/mol, XLogP of 1.74, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(4-bromo-2-fluoroanilino)butane-1,2-diol is sourced from PubChem (CID 126662243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).