C10H14F2N2O3 — CID 126662652
3-[(2S,5S)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one (PubChem CID 126662652) has the molecular formula C10H14F2N2O3 and a molecular weight of 248.23 g/mol. Its IUPAC name is 3-[(2S,5S)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one.
| Compound Name | 3-[(2S,5S)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 126662652 |
| Molecular Formula | C10H14F2N2O3 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[(2S,5S)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]-4,7-dihydro-1H-1,3-diazepin-2-one |
| SMILES | O=C1NCC=CCN1[C@H]1O[C@H](CO)CC1(F)F |
| InChI | InChI=1S/C10H14F2N2O3/c11-10(12)5-7(6-15)17-8(10)14-4-2-1-3-13-9(14)16/h1-2,7-8,15H,3-6H2,(H,13,16)/t7-,8-/m0/s1 |
| InChIKey | XKDHTCPUYGTBEL-YUMQZZPRSA-N |
| XLogP | 0.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|