About [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate
[4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate (PubChem CID 126662745) has the molecular formula C24H22N4O5S
and a molecular weight of 478.53 g/mol. Its IUPAC name is [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate |
| PubChem CID | 126662745 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate |
| SMILES | Nc1ncc(OC(=O)NCCO)c2scc(COc3cccc(NC(=O)c4ccccc4)c3)c12 |
| InChI | InChI=1S/C24H22N4O5S/c25-22-20-16(14-34-21(20)19(12-27-22)33-24(31)26-9-10-29)13-32-18-8-4-7-17(11-18)28-23(30)15-5-2-1-3-6-15/h1-8,11-12,14,29H,9-10,13H2,(H2,25,27)(H,26,31)(H,28,30) |
| InChIKey | SHXVTOWGXZUYDM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate?
The IUPAC name of [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate (CID 126662745) is [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate?
The canonical SMILES for [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate is Nc1ncc(OC(=O)NCCO)c2scc(COc3cccc(NC(=O)c4ccccc4)c3)c12.
What is the InChIKey of [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate?
The InChIKey is SHXVTOWGXZUYDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O5S/c25-22-20-16(14-34-21(20)19(12-27-22)33-24(31)26-9-10-29)13-32-18-8-4-7-17(11-18)28-23(30)15-5-2-1-3-6-15/h1-8,11-12,14,29H,9-10,13H2,(H2,25,27)(H,26,31)(H,28,30).
What are the key properties of [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate?
[4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate has a molecular weight of 478.53 g/mol, XLogP of 3.79, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-3-[(3-benzamidophenoxy)methyl]thieno[3,2-c]pyridin-7-yl] N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 126662745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).