C25H23ClN4O5S — CID 126662760
[4-amino-3-[[3-[(4-chlorophenyl)carbamoyl]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] N-(3-hydroxypropyl)carbamate (PubChem CID 126662760) has the molecular formula C25H23ClN4O5S and a molecular weight of 527.00 g/mol. Its IUPAC name is [4-amino-3-[[3-[(4-chlorophenyl)carbamoyl]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] N-(3-hydroxypropyl)carbamate.
| Compound Name | [4-amino-3-[[3-[(4-chlorophenyl)carbamoyl]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 126662760 |
| Molecular Formula | C25H23ClN4O5S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [4-amino-3-[[3-[(4-chlorophenyl)carbamoyl]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] N-(3-hydroxypropyl)carbamate |
| SMILES | Nc1ncc(OC(=O)NCCCO)c2scc(COc3cccc(C(=O)Nc4ccc(Cl)cc4)c3)c12 |
| InChI | InChI=1S/C25H23ClN4O5S/c26-17-5-7-18(8-6-17)30-24(32)15-3-1-4-19(11-15)34-13-16-14-36-22-20(12-29-23(27)21(16)22)35-25(33)28-9-2-10-31/h1,3-8,11-12,14,31H,2,9-10,13H2,(H2,27,29)(H,28,33)(H,30,32) |
| InChIKey | TVBVDYSDESHDHZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|