C14H27N3 — CID 126662981
(3Z)-9-ethyl-7,7-dimethyl-11-methylidene-1,6-diazacycloundec-3-en-8-amine (PubChem CID 126662981) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (3Z)-9-ethyl-7,7-dimethyl-11-methylidene-1,6-diazacycloundec-3-en-8-amine.
| Compound Name | (3Z)-9-ethyl-7,7-dimethyl-11-methylidene-1,6-diazacycloundec-3-en-8-amine |
|---|---|
| PubChem CID | 126662981 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (3Z)-9-ethyl-7,7-dimethyl-11-methylidene-1,6-diazacycloundec-3-en-8-amine |
| SMILES | C=C1CC(CC)C(N)C(C)(C)NC/C=C\CN1 |
| InChI | InChI=1S/C14H27N3/c1-5-12-10-11(2)16-8-6-7-9-17-14(3,4)13(12)15/h6-7,12-13,16-17H,2,5,8-10,15H2,1,3-4H3/b7-6- |
| InChIKey | IYRVZNOONMEXAW-SREVYHEPSA-N |
| XLogP | 1.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|