About cyclohepta-1,3,5-trien-1-ylmethylurea
cyclohepta-1,3,5-trien-1-ylmethylurea (PubChem CID 126663001) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is cyclohepta-1,3,5-trien-1-ylmethylurea.
Molecular Properties
| Compound Name | cyclohepta-1,3,5-trien-1-ylmethylurea |
| PubChem CID | 126663001 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | cyclohepta-1,3,5-trien-1-ylmethylurea |
| SMILES | NC(=O)NCC1=CC=CC=CC1 |
| InChI | InChI=1S/C9H12N2O/c10-9(12)11-7-8-5-3-1-2-4-6-8/h1-5H,6-7H2,(H3,10,11,12) |
| InChIKey | RZQIHILYWWRRSL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta-1,3,5-trien-1-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,3,5-trien-1-ylmethylurea?
The IUPAC name of cyclohepta-1,3,5-trien-1-ylmethylurea (CID 126663001) is cyclohepta-1,3,5-trien-1-ylmethylurea.
What is the SMILES notation for cyclohepta-1,3,5-trien-1-ylmethylurea?
The canonical SMILES for cyclohepta-1,3,5-trien-1-ylmethylurea is NC(=O)NCC1=CC=CC=CC1.
What is the InChIKey of cyclohepta-1,3,5-trien-1-ylmethylurea?
The InChIKey is RZQIHILYWWRRSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c10-9(12)11-7-8-5-3-1-2-4-6-8/h1-5H,6-7H2,(H3,10,11,12).
What are the key properties of cyclohepta-1,3,5-trien-1-ylmethylurea?
cyclohepta-1,3,5-trien-1-ylmethylurea has a molecular weight of 164.21 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,3,5-trien-1-ylmethylurea is sourced from PubChem (CID 126663001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).