About 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol
2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol (PubChem CID 126663004) has the molecular formula C10H16F2O2
and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol.
Molecular Properties
| Compound Name | 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol |
| PubChem CID | 126663004 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol |
| SMILES | CCC[C@@H]1OC(C2CC2O)CC1(F)F |
| InChI | InChI=1S/C10H16F2O2/c1-2-3-9-10(11,12)5-8(14-9)6-4-7(6)13/h6-9,13H,2-5H2,1H3/t6?,7?,8?,9-/m0/s1 |
| InChIKey | PMRMWKTVJCYXJY-BCZLUZIISA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol?
The IUPAC name of 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol (CID 126663004) is 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol.
What is the SMILES notation for 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol?
The canonical SMILES for 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol is CCC[C@@H]1OC(C2CC2O)CC1(F)F.
What is the InChIKey of 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol?
The InChIKey is PMRMWKTVJCYXJY-BCZLUZIISA-N. The full InChI is InChI=1S/C10H16F2O2/c1-2-3-9-10(11,12)5-8(14-9)6-4-7(6)13/h6-9,13H,2-5H2,1H3/t6?,7?,8?,9-/m0/s1.
What are the key properties of 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol?
2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol has a molecular weight of 206.23 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-4,4-difluoro-5-propyloxolan-2-yl]cyclopropan-1-ol is sourced from PubChem (CID 126663004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).