About N'-(2,6-dichlorophenyl)ethane-1,2-diamine
N'-(2,6-dichlorophenyl)ethane-1,2-diamine (PubChem CID 12666310) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is N'-(2,6-dichlorophenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,6-dichlorophenyl)ethane-1,2-diamine |
| PubChem CID | 12666310 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | N'-(2,6-dichlorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c9-6-2-1-3-7(10)8(6)12-5-4-11/h1-3,12H,4-5,11H2 |
| InChIKey | XEWPCYPDZQFHCM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(2,6-dichlorophenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dichlorophenyl)ethane-1,2-diamine?
The IUPAC name of N'-(2,6-dichlorophenyl)ethane-1,2-diamine (CID 12666310) is N'-(2,6-dichlorophenyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2,6-dichlorophenyl)ethane-1,2-diamine?
The canonical SMILES for N'-(2,6-dichlorophenyl)ethane-1,2-diamine is NCCNc1c(Cl)cccc1Cl.
What is the InChIKey of N'-(2,6-dichlorophenyl)ethane-1,2-diamine?
The InChIKey is XEWPCYPDZQFHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c9-6-2-1-3-7(10)8(6)12-5-4-11/h1-3,12H,4-5,11H2.
What are the key properties of N'-(2,6-dichlorophenyl)ethane-1,2-diamine?
N'-(2,6-dichlorophenyl)ethane-1,2-diamine has a molecular weight of 205.09 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dichlorophenyl)ethane-1,2-diamine is sourced from PubChem (CID 12666310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).