About 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide
2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide (PubChem CID 126663191) has the molecular formula C11H24N4O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide |
| PubChem CID | 126663191 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(C)[C@@H](/C(N)=N/CC(=O)N(C)C)N(C)C |
| InChI | InChI=1S/C11H24N4O/c1-8(2)10(15(5)6)11(12)13-7-9(16)14(3)4/h8,10H,7H2,1-6H3,(H2,12,13)/t10-/m0/s1 |
| InChIKey | POSAYPFRJSZEPQ-JTQLQIEISA-N |
| XLogP | 0.02 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide (CID 126663191) is 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide is CC(C)[C@@H](/C(N)=N/CC(=O)N(C)C)N(C)C.
What is the InChIKey of 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide?
The InChIKey is POSAYPFRJSZEPQ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H24N4O/c1-8(2)10(15(5)6)11(12)13-7-9(16)14(3)4/h8,10H,7H2,1-6H3,(H2,12,13)/t10-/m0/s1.
What are the key properties of 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide?
2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide has a molecular weight of 228.34 g/mol, XLogP of 0.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-1-amino-2-(dimethylamino)-3-methylbutylidene]amino]-N,N-dimethylacetamide is sourced from PubChem (CID 126663191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).