About 3-butoxybut-3-en-2-amine
3-butoxybut-3-en-2-amine (PubChem CID 126663219) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-butoxybut-3-en-2-amine.
Molecular Properties
| Compound Name | 3-butoxybut-3-en-2-amine |
| PubChem CID | 126663219 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 3-butoxybut-3-en-2-amine |
| SMILES | C=C(OCCCC)C(C)N |
| InChI | InChI=1S/C8H17NO/c1-4-5-6-10-8(3)7(2)9/h7H,3-6,9H2,1-2H3 |
| InChIKey | IMOMOMVWSWEGFV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxybut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxybut-3-en-2-amine?
The IUPAC name of 3-butoxybut-3-en-2-amine (CID 126663219) is 3-butoxybut-3-en-2-amine.
What is the SMILES notation for 3-butoxybut-3-en-2-amine?
The canonical SMILES for 3-butoxybut-3-en-2-amine is C=C(OCCCC)C(C)N.
What is the InChIKey of 3-butoxybut-3-en-2-amine?
The InChIKey is IMOMOMVWSWEGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-5-6-10-8(3)7(2)9/h7H,3-6,9H2,1-2H3.
What are the key properties of 3-butoxybut-3-en-2-amine?
3-butoxybut-3-en-2-amine has a molecular weight of 143.23 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxybut-3-en-2-amine is sourced from PubChem (CID 126663219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).