C12H18F3NO — CID 126663489
2-methyl-N-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]propanamide (PubChem CID 126663489) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-methyl-N-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]propanamide.
| Compound Name | 2-methyl-N-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]propanamide |
|---|---|
| PubChem CID | 126663489 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-methyl-N-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]propanamide |
| SMILES | C/C(=C\C=C/C(C)NC(=O)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c1-8(2)11(17)16-10(4)7-5-6-9(3)12(13,14)15/h5-8,10H,1-4H3,(H,16,17)/b7-5-,9-6+ |
| InChIKey | YESSFRTXXOXHBA-XCZNYUDNSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|