C30H40O10 — CID 126663522
[(E,4E)-4-[(11E)-3,12-dimethylidene-11-[2-(2-methylprop-2-enoyloxymethyl)prop-2-enylidene]-1,4,7,10,13,16-hexaoxacyclooctadec-2-ylidene]but-2-enyl] 2-methylprop-2-enoate (PubChem CID 126663522) has the molecular formula C30H40O10 and a molecular weight of 560.64 g/mol. Its IUPAC name is [(E,4E)-4-[(11E)-3,12-dimethylidene-11-[2-(2-methylprop-2-enoyloxymethyl)prop-2-enylidene]-1,4,7,10,13,16-hexaoxacyclooctadec-2-ylidene]but-2-enyl] 2-methylprop-2-enoate.
| Compound Name | [(E,4E)-4-[(11E)-3,12-dimethylidene-11-[2-(2-methylprop-2-enoyloxymethyl)prop-2-enylidene]-1,4,7,10,13,16-hexaoxacyclooctadec-2-ylidene]but-2-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126663522 |
| Molecular Formula | C30H40O10 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [(E,4E)-4-[(11E)-3,12-dimethylidene-11-[2-(2-methylprop-2-enoyloxymethyl)prop-2-enylidene]-1,4,7,10,13,16-hexaoxacyclooctadec-2-ylidene]but-2-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(/C=C1/OCCOCCOC(=C)/C(=C\C=C\COC(=O)C(=C)C)OCCOCCOC1=C)COC(=O)C(=C)C |
| InChI | InChI=1S/C30H40O10/c1-22(2)29(31)39-11-9-8-10-27-25(6)35-16-12-34-15-19-38-28(20-24(5)21-40-30(32)23(3)4)26(7)36-17-13-33-14-18-37-27/h8-10,20H,1,3,5-7,11-19,21H2,2,4H3/b9-8+,27-10+,28-20+ |
| InChIKey | BZKHJOQDASHCRL-DCMNEUGRSA-N |
| XLogP | 4.25 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|