About (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite
(2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite (PubChem CID 126663542) has the molecular formula C12H17F2NS2
and a molecular weight of 277.40 g/mol. Its IUPAC name is (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite |
| PubChem CID | 126663542 |
| Molecular Formula | C12H17F2NS2 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite |
| SMILES | CCCCc1c(C)c(C)c(N)c(SF)c1SF |
| InChI | InChI=1S/C12H17F2NS2/c1-4-5-6-9-7(2)8(3)10(15)12(17-14)11(9)16-13/h4-6,15H2,1-3H3 |
| InChIKey | SRUJMXGWGOGDKL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite?
The IUPAC name of (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite (CID 126663542) is (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite.
What is the SMILES notation for (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite?
The canonical SMILES for (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite is CCCCc1c(C)c(C)c(N)c(SF)c1SF.
What is the InChIKey of (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite?
The InChIKey is SRUJMXGWGOGDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2NS2/c1-4-5-6-9-7(2)8(3)10(15)12(17-14)11(9)16-13/h4-6,15H2,1-3H3.
What are the key properties of (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite?
(2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite has a molecular weight of 277.40 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-butyl-6-fluorosulfanyl-3,4-dimethylphenyl) thiohypofluorite is sourced from PubChem (CID 126663542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).