C24H20N8 — CID 126663710
5,6-bis(benzotriazol-1-yl)-2,7-dimethyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene (PubChem CID 126663710) has the molecular formula C24H20N8 and a molecular weight of 420.48 g/mol. Its IUPAC name is 5,6-bis(benzotriazol-1-yl)-2,7-dimethyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene.
| Compound Name | 5,6-bis(benzotriazol-1-yl)-2,7-dimethyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 126663710 |
| Molecular Formula | C24H20N8 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 5,6-bis(benzotriazol-1-yl)-2,7-dimethyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
| SMILES | Cc1c(-n2nnc3ccccc32)c(-n2nnc3ccccc32)c2nc(C)n3c2c1CCC3 |
| InChI | InChI=1S/C24H20N8/c1-14-16-8-7-13-30-15(2)25-21(23(16)30)24(32-20-12-6-4-10-18(20)27-29-32)22(14)31-19-11-5-3-9-17(19)26-28-31/h3-6,9-12H,7-8,13H2,1-2H3 |
| InChIKey | QJNANDHCMBFHLX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |