About 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline
2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline (PubChem CID 126663737) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline |
| PubChem CID | 126663737 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline |
| SMILES | C=C(C)N1c2c(C)cccc2CCC1C |
| InChI | InChI=1S/C14H19N/c1-10(2)15-12(4)8-9-13-7-5-6-11(3)14(13)15/h5-7,12H,1,8-9H2,2-4H3 |
| InChIKey | YFEROZJMLYSYCL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline?
The IUPAC name of 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline (CID 126663737) is 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline is C=C(C)N1c2c(C)cccc2CCC1C.
What is the InChIKey of 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline?
The InChIKey is YFEROZJMLYSYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-10(2)15-12(4)8-9-13-7-5-6-11(3)14(13)15/h5-7,12H,1,8-9H2,2-4H3.
What are the key properties of 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline?
2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline has a molecular weight of 201.31 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-1-prop-1-en-2-yl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 126663737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).