C18H30N2 — CID 126663764
(1Z,3Z)-3-[(Z)-1-(3,3-dimethylbutan-2-ylideneamino)prop-1-enyl]-N-ethyl-4-methylhexa-1,3,5-trien-1-amine (PubChem CID 126663764) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is (1Z,3Z)-3-[(Z)-1-(3,3-dimethylbutan-2-ylideneamino)prop-1-enyl]-N-ethyl-4-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-[(Z)-1-(3,3-dimethylbutan-2-ylideneamino)prop-1-enyl]-N-ethyl-4-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 126663764 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (1Z,3Z)-3-[(Z)-1-(3,3-dimethylbutan-2-ylideneamino)prop-1-enyl]-N-ethyl-4-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(C)=C(/C=C\NCC)C(=C\C)\N=C(/C)C(C)(C)C |
| InChI | InChI=1S/C18H30N2/c1-9-14(4)16(12-13-19-11-3)17(10-2)20-15(5)18(6,7)8/h9-10,12-13,19H,1,11H2,2-8H3/b13-12-,16-14-,17-10-,20-15+ |
| InChIKey | DBHJDVPXHFTXCL-IHHNZLTRSA-N |
| XLogP | 5.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|