C9H9N3OS2 — CID 126664103
N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]formamide (PubChem CID 126664103) has the molecular formula C9H9N3OS2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]formamide.
| Compound Name | N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]formamide |
|---|---|
| PubChem CID | 126664103 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | N-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]formamide |
| SMILES | Cc1nc(C)c(-c2csc(NC=O)n2)s1 |
| InChI | InChI=1S/C9H9N3OS2/c1-5-8(15-6(2)11-5)7-3-14-9(12-7)10-4-13/h3-4H,1-2H3,(H,10,12,13) |
| InChIKey | RZRKGCRGBNKTNV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|