About 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one
4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one (PubChem CID 126664261) has the molecular formula C15H18BrN3O2
and a molecular weight of 352.23 g/mol. Its IUPAC name is 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one |
| PubChem CID | 126664261 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one |
| SMILES | Cc1c2c(O[C@H](C)C3CNC(=O)C3)cc(Br)cc2nn1C |
| InChI | InChI=1S/C15H18BrN3O2/c1-8-15-12(18-19(8)3)5-11(16)6-13(15)21-9(2)10-4-14(20)17-7-10/h5-6,9-10H,4,7H2,1-3H3,(H,17,20)/t9-,10?/m1/s1 |
| InChIKey | MTGUCXNVIRCRIN-YHMJZVADSA-N |
| XLogP | 2.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one?
The IUPAC name of 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one (CID 126664261) is 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one?
The canonical SMILES for 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one is Cc1c2c(O[C@H](C)C3CNC(=O)C3)cc(Br)cc2nn1C.
What is the InChIKey of 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one?
The InChIKey is MTGUCXNVIRCRIN-YHMJZVADSA-N. The full InChI is InChI=1S/C15H18BrN3O2/c1-8-15-12(18-19(8)3)5-11(16)6-13(15)21-9(2)10-4-14(20)17-7-10/h5-6,9-10H,4,7H2,1-3H3,(H,17,20)/t9-,10?/m1/s1.
What are the key properties of 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one?
4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one has a molecular weight of 352.23 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-(6-bromo-2,3-dimethylindazol-4-yl)oxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 126664261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).