About 6-fluoro-2,3-dimethoxyquinoxaline
6-fluoro-2,3-dimethoxyquinoxaline (PubChem CID 12666545) has the molecular formula C10H9FN2O2
and a molecular weight of 208.19 g/mol. Its IUPAC name is 6-fluoro-2,3-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 6-fluoro-2,3-dimethoxyquinoxaline |
| PubChem CID | 12666545 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6-fluoro-2,3-dimethoxyquinoxaline |
| SMILES | COc1nc2ccc(F)cc2nc1OC |
| InChI | InChI=1S/C10H9FN2O2/c1-14-9-10(15-2)13-8-5-6(11)3-4-7(8)12-9/h3-5H,1-2H3 |
| InChIKey | HPWIFAJTLXGSHJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2,3-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dimethoxyquinoxaline?
The IUPAC name of 6-fluoro-2,3-dimethoxyquinoxaline (CID 12666545) is 6-fluoro-2,3-dimethoxyquinoxaline.
What is the SMILES notation for 6-fluoro-2,3-dimethoxyquinoxaline?
The canonical SMILES for 6-fluoro-2,3-dimethoxyquinoxaline is COc1nc2ccc(F)cc2nc1OC.
What is the InChIKey of 6-fluoro-2,3-dimethoxyquinoxaline?
The InChIKey is HPWIFAJTLXGSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O2/c1-14-9-10(15-2)13-8-5-6(11)3-4-7(8)12-9/h3-5H,1-2H3.
What are the key properties of 6-fluoro-2,3-dimethoxyquinoxaline?
6-fluoro-2,3-dimethoxyquinoxaline has a molecular weight of 208.19 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dimethoxyquinoxaline is sourced from PubChem (CID 12666545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).