C23H29N3OS — CID 126665925
(R)-N-[1-(3-aminophenyl)-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-methylpropane-2-sulfinamide (PubChem CID 126665925) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is (R)-N-[1-(3-aminophenyl)-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(3-aminophenyl)-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 126665925 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (R)-N-[1-(3-aminophenyl)-1-(4-cyanophenyl)-3-cyclopropylpropyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)NC(CCC1CC1)(c1ccc(C#N)cc1)c1cccc(N)c1 |
| InChI | InChI=1S/C23H29N3OS/c1-22(2,3)28(27)26-23(14-13-17-7-8-17,20-5-4-6-21(25)15-20)19-11-9-18(16-24)10-12-19/h4-6,9-12,15,17,26H,7-8,13-14,25H2,1-3H3/t23?,28-/m1/s1 |
| InChIKey | CKXAYRKBXUDIMV-GBAZGAGXSA-N |
| XLogP | 4.63 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|