About 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine
1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 126666484) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine |
| PubChem CID | 126666484 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | Cc1ccc(N2CCN=C2N)c(C)c1 |
| InChI | InChI=1S/C11H15N3/c1-8-3-4-10(9(2)7-8)14-6-5-13-11(14)12/h3-4,7H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | JBSYGTSDQBORCX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine (CID 126666484) is 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine is Cc1ccc(N2CCN=C2N)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The InChIKey is JBSYGTSDQBORCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-8-3-4-10(9(2)7-8)14-6-5-13-11(14)12/h3-4,7H,5-6H2,1-2H3,(H2,12,13).
What are the key properties of 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine has a molecular weight of 189.26 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 126666484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).