About 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine
6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 126666573) has the molecular formula C15H16BrN3O3
and a molecular weight of 366.22 g/mol. Its IUPAC name is 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
| PubChem CID | 126666573 |
| Molecular Formula | C15H16BrN3O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | C[C@@H]1C[C@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CCO1 |
| InChI | InChI=1S/C15H16BrN3O3/c1-9-6-11(4-5-22-9)18-15-12-7-10(16)2-3-13(12)17-8-14(15)19(20)21/h2-3,7-9,11H,4-6H2,1H3,(H,17,18)/t9-,11-/m1/s1 |
| InChIKey | KLXJHMMBVKUGRD-MWLCHTKSSA-N |
| XLogP | 3.88 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine?
The IUPAC name of 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine (CID 126666573) is 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine.
What is the SMILES notation for 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine?
The canonical SMILES for 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine is C[C@@H]1C[C@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CCO1.
What is the InChIKey of 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine?
The InChIKey is KLXJHMMBVKUGRD-MWLCHTKSSA-N. The full InChI is InChI=1S/C15H16BrN3O3/c1-9-6-11(4-5-22-9)18-15-12-7-10(16)2-3-13(12)17-8-14(15)19(20)21/h2-3,7-9,11H,4-6H2,1H3,(H,17,18)/t9-,11-/m1/s1.
What are the key properties of 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine?
6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine has a molecular weight of 366.22 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine is sourced from PubChem (CID 126666573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).