C15H18FN3O — CID 126666633
6-fluoro-4-N-[(2R,4R)-2-methyloxan-4-yl]quinoline-3,4-diamine (PubChem CID 126666633) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-fluoro-4-N-[(2R,4R)-2-methyloxan-4-yl]quinoline-3,4-diamine.
| Compound Name | 6-fluoro-4-N-[(2R,4R)-2-methyloxan-4-yl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 126666633 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 6-fluoro-4-N-[(2R,4R)-2-methyloxan-4-yl]quinoline-3,4-diamine |
| SMILES | C[C@@H]1C[C@H](Nc2c(N)cnc3ccc(F)cc23)CCO1 |
| InChI | InChI=1S/C15H18FN3O/c1-9-6-11(4-5-20-9)19-15-12-7-10(16)2-3-14(12)18-8-13(15)17/h2-3,7-9,11H,4-6,17H2,1H3,(H,18,19)/t9-,11-/m1/s1 |
| InChIKey | CARCASYFMHZEEN-MWLCHTKSSA-N |
| XLogP | 2.94 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |