About 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine
6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine (PubChem CID 126666762) has the molecular formula C14H13BrFN3O2
and a molecular weight of 354.18 g/mol. Its IUPAC name is 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine |
| PubChem CID | 126666762 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(Br)cc2c1N[C@H]1CC[C@@H](F)C1 |
| InChI | InChI=1S/C14H13BrFN3O2/c15-8-1-4-12-11(5-8)14(13(7-17-12)19(20)21)18-10-3-2-9(16)6-10/h1,4-5,7,9-10H,2-3,6H2,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | MKPLOVWUEXAPRL-ZJUUUORDSA-N |
| XLogP | 4.21 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine?
The IUPAC name of 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine (CID 126666762) is 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine.
What is the SMILES notation for 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine?
The canonical SMILES for 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine is O=[N+]([O-])c1cnc2ccc(Br)cc2c1N[C@H]1CC[C@@H](F)C1.
What is the InChIKey of 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine?
The InChIKey is MKPLOVWUEXAPRL-ZJUUUORDSA-N. The full InChI is InChI=1S/C14H13BrFN3O2/c15-8-1-4-12-11(5-8)14(13(7-17-12)19(20)21)18-10-3-2-9(16)6-10/h1,4-5,7,9-10H,2-3,6H2,(H,17,18)/t9-,10+/m1/s1.
What are the key properties of 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine?
6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine has a molecular weight of 354.18 g/mol, XLogP of 4.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(1S,3R)-3-fluorocyclopentyl]-3-nitroquinolin-4-amine is sourced from PubChem (CID 126666762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).