C18H20FN7O3 — CID 126666918
4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-3-pyridinyl)methyl]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666918) has the molecular formula C18H20FN7O3 and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-3-pyridinyl)methyl]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-3-pyridinyl)methyl]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666918 |
| Molecular Formula | C18H20FN7O3 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-[(5-fluoro-3-pyridinyl)methyl]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cncc(F)c1)C(=O)c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C18H20FN7O3/c1-26(7-9-4-10(19)6-20-5-9)18(29)14-13-16(21-8-22-17(13)25-24-14)23-11-2-3-12(27)15(11)28/h4-6,8,11-12,15,27-28H,2-3,7H2,1H3,(H2,21,22,23,24,25)/t11-,12-,15+/m1/s1 |
| InChIKey | NKKYUXKHMSOZCF-JMSVASOKSA-N |
| XLogP | 0.46 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |