C20H20F4N6O3 — CID 126666958
4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-N-[(1S)-1-(2,5-difluorophenyl)-2-hydroxyethyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666958) has the molecular formula C20H20F4N6O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is 4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-N-[(1S)-1-(2,5-difluorophenyl)-2-hydroxyethyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | 4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-N-[(1S)-1-(2,5-difluorophenyl)-2-hydroxyethyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666958 |
| Molecular Formula | C20H20F4N6O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-N-[(1S)-1-(2,5-difluorophenyl)-2-hydroxyethyl]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | O=C(N[C@H](CO)c1cc(F)ccc1F)c1[nH]nc2ncnc(N[C@@H]3C[C@@H](C(F)F)C[C@H]3O)c12 |
| InChI | InChI=1S/C20H20F4N6O3/c21-9-1-2-11(22)10(5-9)13(6-31)28-20(33)16-15-18(25-7-26-19(15)30-29-16)27-12-3-8(17(23)24)4-14(12)32/h1-2,5,7-8,12-14,17,31-32H,3-4,6H2,(H,28,33)(H2,25,26,27,29,30)/t8-,12-,13-,14-/m1/s1 |
| InChIKey | FAHKVZGCNFCHPS-HKSFMPNISA-N |
| XLogP | 1.91 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |