C22H21F5N6O2 — CID 126666967
[4-[[(2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone (PubChem CID 126666967) has the molecular formula C22H21F5N6O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is [4-[[(2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone.
| Compound Name | [4-[[(2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 126666967 |
| Molecular Formula | C22H21F5N6O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [4-[[(2S)-3,3-difluoro-2-hydroxycyclohexyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone |
| SMILES | O=C(c1[nH]nc2ncnc(NC3CCCC(F)(F)[C@H]3O)c12)N1C[C@@H](F)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H21F5N6O2/c23-10-3-4-13(25)12(6-10)15-7-11(24)8-33(15)21(35)17-16-19(28-9-29-20(16)32-31-17)30-14-2-1-5-22(26,27)18(14)34/h3-4,6,9,11,14-15,18,34H,1-2,5,7-8H2,(H2,28,29,30,31,32)/t11-,14?,15+,18-/m0/s1 |
| InChIKey | XYTYESOSTZVNME-BOOYNXLISA-N |
| XLogP | 3.52 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |