C29H41ClF3N — CID 126666989
N-[(1Z,3Z)-3-[5-chloro-2-(3,3,3-trifluoropropyl)phenyl]-2-ethylhexa-1,3,5-trienyl]-N,2-dimethyldec-1-en-3-amine (PubChem CID 126666989) has the molecular formula C29H41ClF3N and a molecular weight of 496.10 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-[5-chloro-2-(3,3,3-trifluoropropyl)phenyl]-2-ethylhexa-1,3,5-trienyl]-N,2-dimethyldec-1-en-3-amine.
| Compound Name | N-[(1Z,3Z)-3-[5-chloro-2-(3,3,3-trifluoropropyl)phenyl]-2-ethylhexa-1,3,5-trienyl]-N,2-dimethyldec-1-en-3-amine |
|---|---|
| PubChem CID | 126666989 |
| Molecular Formula | C29H41ClF3N |
| Molecular Weight | 496.10 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-[(1Z,3Z)-3-[5-chloro-2-(3,3,3-trifluoropropyl)phenyl]-2-ethylhexa-1,3,5-trienyl]-N,2-dimethyldec-1-en-3-amine |
| SMILES | C=C/C=C(C(=C/N(C)C(CCCCCCC)C(=C)C)\CC)/c1cc(Cl)ccc1CCC(F)(F)F |
| InChI | InChI=1S/C29H41ClF3N/c1-7-10-11-12-13-15-28(22(4)5)34(6)21-23(9-3)26(14-8-2)27-20-25(30)17-16-24(27)18-19-29(31,32)33/h8,14,16-17,20-21,28H,2,4,7,9-13,15,18-19H2,1,3,5-6H3/b23-21-,26-14+ |
| InChIKey | ACQVYWBEUSKSPE-OEOOJTCSSA-N |
| XLogP | 9.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.10 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|