C18H19ClFN7O3 — CID 126667033
N-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126667033) has the molecular formula C18H19ClFN7O3 and a molecular weight of 435.85 g/mol. Its IUPAC name is N-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126667033 |
| Molecular Formula | C18H19ClFN7O3 |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cc(F)cnc1Cl)C(=O)c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C18H19ClFN7O3/c1-27(6-8-4-9(20)5-21-15(8)19)18(30)13-12-16(22-7-23-17(12)26-25-13)24-10-2-3-11(28)14(10)29/h4-5,7,10-11,14,28-29H,2-3,6H2,1H3,(H2,22,23,24,25,26)/t10-,11-,14+/m1/s1 |
| InChIKey | JAXJZVIGZVTLHI-GYSYKLTISA-N |
| XLogP | 1.11 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|