C21H21ClF2N6O3 — CID 126667066
[(2R,4S)-2-(5-chloro-2-fluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone (PubChem CID 126667066) has the molecular formula C21H21ClF2N6O3 and a molecular weight of 478.89 g/mol. Its IUPAC name is [(2R,4S)-2-(5-chloro-2-fluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone.
| Compound Name | [(2R,4S)-2-(5-chloro-2-fluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 126667066 |
| Molecular Formula | C21H21ClF2N6O3 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(2R,4S)-2-(5-chloro-2-fluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
| SMILES | O=C(c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12)N1C[C@@H](F)C[C@@H]1c1cc(Cl)ccc1F |
| InChI | InChI=1S/C21H21ClF2N6O3/c22-9-1-2-12(24)11(5-9)14-6-10(23)7-30(14)21(33)17-16-19(25-8-26-20(16)29-28-17)27-13-3-4-15(31)18(13)32/h1-2,5,8,10,13-15,18,31-32H,3-4,6-7H2,(H2,25,26,27,28,29)/t10-,13+,14+,15+,18-/m0/s1 |
| InChIKey | BETOGYPBNWDGAK-YHUZLLMVSA-N |
| XLogP | 2.37 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |