C24H26F2N8O3 — CID 126667288
N-[2-(difluoromethoxy)-4-[3-(dimethylamino)azetidin-1-yl]-5-nitrophenyl]-6-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,2-dihydropyrimidin-2-amine (PubChem CID 126667288) has the molecular formula C24H26F2N8O3 and a molecular weight of 512.52 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-[3-(dimethylamino)azetidin-1-yl]-5-nitrophenyl]-6-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,2-dihydropyrimidin-2-amine.
| Compound Name | N-[2-(difluoromethoxy)-4-[3-(dimethylamino)azetidin-1-yl]-5-nitrophenyl]-6-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,2-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 126667288 |
| Molecular Formula | C24H26F2N8O3 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-[3-(dimethylamino)azetidin-1-yl]-5-nitrophenyl]-6-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1,2-dihydropyrimidin-2-amine |
| SMILES | CN(C)C1CN(c2cc(OC(F)F)c(NC3N=CC=C(c4cn(C)c5cccnc45)N3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C24H26F2N8O3/c1-31(2)14-11-33(12-14)19-10-21(37-23(25)26)17(9-20(19)34(35)36)30-24-28-8-6-16(29-24)15-13-32(3)18-5-4-7-27-22(15)18/h4-10,13-14,23-24,29-30H,11-12H2,1-3H3 |
| InChIKey | KZZQEDXIXAQCOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|