C16H11NO4 — CID 126667478
4-(5-cyano-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxybenzoic acid (PubChem CID 126667478) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(5-cyano-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxybenzoic acid.
| Compound Name | 4-(5-cyano-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 126667478 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-(5-cyano-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxybenzoic acid |
| SMILES | N#Cc1cc2c(c(-c3ccc(C(=O)O)c(O)c3)c1)OCC2 |
| InChI | InChI=1S/C16H11NO4/c17-8-9-5-11-3-4-21-15(11)13(6-9)10-1-2-12(16(19)20)14(18)7-10/h1-2,5-7,18H,3-4H2,(H,19,20) |
| InChIKey | WZNKNNAXHWUUNN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |