C27H22F8O5S — CID 126668448
(2,3,4,5,6-pentafluorophenyl) (4S)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate (PubChem CID 126668448) has the molecular formula C27H22F8O5S and a molecular weight of 610.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4S)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
|---|---|
| PubChem CID | 126668448 |
| Molecular Formula | C27H22F8O5S |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
| SMILES | COCCCCc1cc(C(F)(F)F)ccc1[C@@H]1CCOc2cc(S(=O)(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C27H22F8O5S/c1-38-10-3-2-4-14-12-15(27(33,34)35)5-7-17(14)18-9-11-39-20-13-16(6-8-19(18)20)41(36,37)40-26-24(31)22(29)21(28)23(30)25(26)32/h5-8,12-13,18H,2-4,9-11H2,1H3/t18-/m0/s1 |
| InChIKey | XQRKWQPBGCUCDY-SFHVURJKSA-N |
| XLogP | 7.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|