C29H19F8NO4S — CID 126668454
(2,3,4,5,6-pentafluorophenyl) (4S)-4-methyl-4-[2-(6-methyl-3-pyridinyl)-4-(trifluoromethyl)phenyl]-2,3-dihydrochromene-7-sulfonate (PubChem CID 126668454) has the molecular formula C29H19F8NO4S and a molecular weight of 629.53 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4S)-4-methyl-4-[2-(6-methyl-3-pyridinyl)-4-(trifluoromethyl)phenyl]-2,3-dihydrochromene-7-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-methyl-4-[2-(6-methyl-3-pyridinyl)-4-(trifluoromethyl)phenyl]-2,3-dihydrochromene-7-sulfonate |
|---|---|
| PubChem CID | 126668454 |
| Molecular Formula | C29H19F8NO4S |
| Molecular Weight | 629.53 g/mol |
| Exact Mass | 629.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-methyl-4-[2-(6-methyl-3-pyridinyl)-4-(trifluoromethyl)phenyl]-2,3-dihydrochromene-7-sulfonate |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)ccc2[C@]2(C)CCOc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)cn1 |
| InChI | InChI=1S/C29H19F8NO4S/c1-14-3-4-15(13-38-14)18-11-16(29(35,36)37)5-7-19(18)28(2)9-10-41-21-12-17(6-8-20(21)28)43(39,40)42-27-25(33)23(31)22(30)24(32)26(27)34/h3-8,11-13H,9-10H2,1-2H3/t28-/m0/s1 |
| InChIKey | OSSHCJCYIDQLNH-NDEPHWFRSA-N |
| XLogP | 7.63 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.53 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|