C29H22F4N2O5S — CID 126668509
4-[2-[(4S)-7-[(6-fluoro-2-pyridinyl)sulfamoyl]-4-methyl-2,3-dihydrochromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 126668509) has the molecular formula C29H22F4N2O5S and a molecular weight of 586.56 g/mol. Its IUPAC name is 4-[2-[(4S)-7-[(6-fluoro-2-pyridinyl)sulfamoyl]-4-methyl-2,3-dihydrochromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-[2-[(4S)-7-[(6-fluoro-2-pyridinyl)sulfamoyl]-4-methyl-2,3-dihydrochromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 126668509 |
| Molecular Formula | C29H22F4N2O5S |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | 4-[2-[(4S)-7-[(6-fluoro-2-pyridinyl)sulfamoyl]-4-methyl-2,3-dihydrochromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | C[C@@]1(c2ccc(C(F)(F)F)cc2-c2ccc(C(=O)O)cc2)CCOc2cc(S(=O)(=O)Nc3cccc(F)n3)ccc21 |
| InChI | InChI=1S/C29H22F4N2O5S/c1-28(22-11-9-19(29(31,32)33)15-21(22)17-5-7-18(8-6-17)27(36)37)13-14-40-24-16-20(10-12-23(24)28)41(38,39)35-26-4-2-3-25(30)34-26/h2-12,15-16H,13-14H2,1H3,(H,34,35)(H,36,37)/t28-/m0/s1 |
| InChIKey | KQWFJJWHDISFSZ-NDEPHWFRSA-N |
| XLogP | 6.49 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|