C33H24F8O6S — CID 126668786
tert-butyl 4-[2-[(4S)-7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate (PubChem CID 126668786) has the molecular formula C33H24F8O6S and a molecular weight of 700.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4S)-7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate.
| Compound Name | tert-butyl 4-[2-[(4S)-7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 126668786 |
| Molecular Formula | C33H24F8O6S |
| Molecular Weight | 700.60 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | tert-butyl 4-[2-[(4S)-7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2cc(C(F)(F)F)ccc2[C@@H]2CCOc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)cc1 |
| InChI | InChI=1S/C33H24F8O6S/c1-32(2,3)46-31(42)17-6-4-16(5-7-17)23-14-18(33(39,40)41)8-10-20(23)21-12-13-45-24-15-19(9-11-22(21)24)48(43,44)47-30-28(37)26(35)25(34)27(36)29(30)38/h4-11,14-15,21H,12-13H2,1-3H3/t21-/m0/s1 |
| InChIKey | JBRSTDUDKBPRMT-NRFANRHFSA-N |
| XLogP | 8.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.60 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|